C18H24ClF3N4O2 — CID 175884045
tert-butyl (3aS,6aR)-5-[[6-chloro-4-methyl-5-(trifluoromethyl)pyridazin-3-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 175884045) has the molecular formula C18H24ClF3N4O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[[6-chloro-4-methyl-5-(trifluoromethyl)pyridazin-3-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[[6-chloro-4-methyl-5-(trifluoromethyl)pyridazin-3-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 175884045 |
| Molecular Formula | C18H24ClF3N4O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[[6-chloro-4-methyl-5-(trifluoromethyl)pyridazin-3-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | Cc1c(NC2C[C@@H]3CN(C(=O)OC(C)(C)C)C[C@@H]3C2)nnc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C18H24ClF3N4O2/c1-9-13(18(20,21)22)14(19)24-25-15(9)23-12-5-10-7-26(8-11(10)6-12)16(27)28-17(2,3)4/h10-12H,5-8H2,1-4H3,(H,23,25)/t10-,11+,12? |
| InChIKey | HKTOOQDXVRZWNF-FOSCPWQOSA-N |
| XLogP | 4.51 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |