C18H23ClN4O2S — CID 171043568
tert-butyl (3aS,6aR)-5-[(4-chlorothieno[2,3-d]pyridazin-7-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 171043568) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[(4-chlorothieno[2,3-d]pyridazin-7-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[(4-chlorothieno[2,3-d]pyridazin-7-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 171043568 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[(4-chlorothieno[2,3-d]pyridazin-7-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(Nc3nnc(Cl)c4ccsc34)C[C@H]2C1 |
| InChI | InChI=1S/C18H23ClN4O2S/c1-18(2,3)25-17(24)23-8-10-6-12(7-11(10)9-23)20-16-14-13(4-5-26-14)15(19)21-22-16/h4-5,10-12H,6-9H2,1-3H3,(H,20,22)/t10-,11+,12? |
| InChIKey | HNZWOCUJHMQCER-FOSCPWQOSA-N |
| XLogP | 4.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |