About methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate
methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate (PubChem CID 175884109) has the molecular formula C20H34O5
and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate.
Molecular Properties
| Compound Name | methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate |
| PubChem CID | 175884109 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate |
| SMILES | C=CCOC(=O)COCCC(C)C.CCCCCCC#CC(=O)OC |
| InChI | InChI=1S/C10H18O3.C10H16O2/c1-4-6-13-10(11)8-12-7-5-9(2)3;1-3-4-5-6-7-8-9-10(11)12-2/h4,9H,1,5-8H2,2-3H3;3-7H2,1-2H3 |
| InChIKey | BTWBAWHWJKCULG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate?
The IUPAC name of methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate (CID 175884109) is methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate.
What is the SMILES notation for methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate?
The canonical SMILES for methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate is C=CCOC(=O)COCCC(C)C.CCCCCCC#CC(=O)OC.
What is the InChIKey of methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate?
The InChIKey is BTWBAWHWJKCULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C10H16O2/c1-4-6-13-10(11)8-12-7-5-9(2)3;1-3-4-5-6-7-8-9-10(11)12-2/h4,9H,1,5-8H2,2-3H3;3-7H2,1-2H3.
What are the key properties of methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate?
methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate has a molecular weight of 354.49 g/mol, XLogP of 3.91, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl non-2-ynoate;prop-2-enyl 2-(3-methylbutoxy)acetate is sourced from PubChem (CID 175884109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).