C24H32N4O — CID 175884206
(3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-(4-methyl-6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 175884206) has the molecular formula C24H32N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-(4-methyl-6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-(4-methyl-6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 175884206 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-(4-methyl-6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [2H]C([2H])(C1CCOCC1)N1C[C@H]2CC(Nc3nnc(-c4ccccc4)cc3C)C[C@H]2C1 |
| InChI | InChI=1S/C24H32N4O/c1-17-11-23(19-5-3-2-4-6-19)26-27-24(17)25-22-12-20-15-28(16-21(20)13-22)14-18-7-9-29-10-8-18/h2-6,11,18,20-22H,7-10,12-16H2,1H3,(H,25,27)/t20-,21+,22?/i14D2 |
| InChIKey | OYYNRROHHIKKRT-OPGWLABISA-N |
| XLogP | 4.00 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |