C25H33FN4O3S — CID 167431515
N-[6-(5-fluoro-2-methylphenyl)-4-methylsulfonylpyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 167431515) has the molecular formula C25H33FN4O3S and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[6-(5-fluoro-2-methylphenyl)-4-methylsulfonylpyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-[6-(5-fluoro-2-methylphenyl)-4-methylsulfonylpyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 167431515 |
| Molecular Formula | C25H33FN4O3S |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[6-(5-fluoro-2-methylphenyl)-4-methylsulfonylpyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cc1ccc(F)cc1-c1cc(S(C)(=O)=O)c(NC2CC3CN(CC4CCOCC4)CC3C2)nn1 |
| InChI | InChI=1S/C25H33FN4O3S/c1-16-3-4-20(26)11-22(16)23-12-24(34(2,31)32)25(29-28-23)27-21-9-18-14-30(15-19(18)10-21)13-17-5-7-33-8-6-17/h3-4,11-12,17-19,21H,5-10,13-15H2,1-2H3,(H,27,29) |
| InChIKey | RYIMRTZFEHYNSE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |