C24H29ClFN3O — CID 161011811
(3aS,6aR)-5-[[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]methyl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 161011811) has the molecular formula C24H29ClFN3O and a molecular weight of 429.97 g/mol. Its IUPAC name is (3aS,6aR)-5-[[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]methyl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-5-[[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]methyl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 161011811 |
| Molecular Formula | C24H29ClFN3O |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (3aS,6aR)-5-[[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]methyl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Fc1ccc(Cl)c(-c2ccc(CC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)c1 |
| InChI | InChI=1S/C24H29ClFN3O/c25-23-3-1-20(26)12-22(23)24-4-2-21(27-28-24)11-17-9-18-14-29(15-19(18)10-17)13-16-5-7-30-8-6-16/h1-4,12,16-19H,5-11,13-15H2/t17?,18-,19+ |
| InChIKey | TXFHTNHFRUTWKW-YQQQUEKLSA-N |
| XLogP | 4.86 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |