C24H28FN5O — CID 142563557
2-[6-[[(3aS,6aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-4-fluorobenzonitrile (PubChem CID 142563557) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[6-[[(3aS,6aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-4-fluorobenzonitrile.
| Compound Name | 2-[6-[[(3aS,6aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 142563557 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[6-[[(3aS,6aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1-c1ccc(NC2C[C@@H]3CN(CC4CCOCC4)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C24H28FN5O/c25-20-2-1-17(12-26)22(11-20)23-3-4-24(29-28-23)27-21-9-18-14-30(15-19(18)10-21)13-16-5-7-31-8-6-16/h1-4,11,16,18-19,21H,5-10,13-15H2,(H,27,29)/t18-,19+,21? |
| InChIKey | VCQXEXFXHXMBOB-PMSBKCLSSA-N |
| XLogP | 3.70 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |