C24H30FN5O2 — CID 165403968
4-[6-[[(3aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-3-fluorobenzamide (PubChem CID 165403968) has the molecular formula C24H30FN5O2 and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[6-[[(3aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-3-fluorobenzamide.
| Compound Name | 4-[6-[[(3aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 165403968 |
| Molecular Formula | C24H30FN5O2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 4-[6-[[(3aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-3-fluorobenzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(NC3CC4CN(CC5CCOCC5)C[C@H]4C3)nn2)c(F)c1 |
| InChI | InChI=1S/C24H30FN5O2/c25-21-11-16(24(26)31)1-2-20(21)22-3-4-23(29-28-22)27-19-9-17-13-30(14-18(17)10-19)12-15-5-7-32-8-6-15/h1-4,11,15,17-19H,5-10,12-14H2,(H2,26,31)(H,27,29)/t17-,18?,19?/m1/s1 |
| InChIKey | PKTADSSFTJAUGS-LMDPOFIKSA-N |
| XLogP | 2.93 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |