C23H36N4O3S — CID 166793851
(3aS,6aR)-N-(6-cyclohexylsulfonylpyridazin-3-yl)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 166793851) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is (3aS,6aR)-N-(6-cyclohexylsulfonylpyridazin-3-yl)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-N-(6-cyclohexylsulfonylpyridazin-3-yl)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166793851 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (3aS,6aR)-N-(6-cyclohexylsulfonylpyridazin-3-yl)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | O=S(=O)(c1ccc(NC2C[C@@H]3CN(CC4CCOCC4)C[C@@H]3C2)nn1)C1CCCCC1 |
| InChI | InChI=1S/C23H36N4O3S/c28-31(29,21-4-2-1-3-5-21)23-7-6-22(25-26-23)24-20-12-18-15-27(16-19(18)13-20)14-17-8-10-30-11-9-17/h6-7,17-21H,1-5,8-16H2,(H,24,25)/t18-,19+,20? |
| InChIKey | LDWRNUHETKTJBL-YOFSQIOKSA-N |
| XLogP | 3.13 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |