C15H19N3O2S2 — CID 53073262
6-cyclohexylsulfonyl-N-(thiophen-2-ylmethyl)pyridazin-3-amine (PubChem CID 53073262) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 6-cyclohexylsulfonyl-N-(thiophen-2-ylmethyl)pyridazin-3-amine.
| Compound Name | 6-cyclohexylsulfonyl-N-(thiophen-2-ylmethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 53073262 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 6-cyclohexylsulfonyl-N-(thiophen-2-ylmethyl)pyridazin-3-amine |
| SMILES | O=S(=O)(c1ccc(NCc2cccs2)nn1)C1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2S2/c19-22(20,13-6-2-1-3-7-13)15-9-8-14(17-18-15)16-11-12-5-4-10-21-12/h4-5,8-10,13H,1-3,6-7,11H2,(H,16,17) |
| InChIKey | RPKGEWXSTRDVAK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |