C25H30F4N4O2 — CID 168795190
[4-[6-[[(3aR,6aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-5-(trifluoromethyl)pyridazin-3-yl]-3-fluorophenyl]methanol (PubChem CID 168795190) has the molecular formula C25H30F4N4O2 and a molecular weight of 494.53 g/mol. Its IUPAC name is [4-[6-[[(3aR,6aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-5-(trifluoromethyl)pyridazin-3-yl]-3-fluorophenyl]methanol.
| Compound Name | [4-[6-[[(3aR,6aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-5-(trifluoromethyl)pyridazin-3-yl]-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 168795190 |
| Molecular Formula | C25H30F4N4O2 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [4-[6-[[(3aR,6aS)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]-5-(trifluoromethyl)pyridazin-3-yl]-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(-c2cc(C(F)(F)F)c(NC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)c(F)c1 |
| InChI | InChI=1S/C25H30F4N4O2/c26-22-7-16(14-34)1-2-20(22)23-10-21(25(27,28)29)24(32-31-23)30-19-8-17-12-33(13-18(17)9-19)11-15-3-5-35-6-4-15/h1-2,7,10,15,17-19,34H,3-6,8-9,11-14H2,(H,30,32)/t17-,18+,19? |
| InChIKey | RGXCOKSHPMFVLT-DFNIBXOVSA-N |
| XLogP | 4.34 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |