C26H31F3N6O — CID 168795137
N-[6-(3-methylbenzimidazol-5-yl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795137) has the molecular formula C26H31F3N6O and a molecular weight of 500.57 g/mol. Its IUPAC name is N-[6-(3-methylbenzimidazol-5-yl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-[6-(3-methylbenzimidazol-5-yl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795137 |
| Molecular Formula | C26H31F3N6O |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-[6-(3-methylbenzimidazol-5-yl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cn1cnc2ccc(-c3cc(C(F)(F)F)c(NC4CC5CN(CC6CCOCC6)CC5C4)nn3)cc21 |
| InChI | InChI=1S/C26H31F3N6O/c1-34-15-30-22-3-2-17(10-24(22)34)23-11-21(26(27,28)29)25(33-32-23)31-20-8-18-13-35(14-19(18)9-20)12-16-4-6-36-7-5-16/h2-3,10-11,15-16,18-20H,4-9,12-14H2,1H3,(H,31,33) |
| InChIKey | ALXJHEHPVIRJOW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |