C25H27F4N5O — CID 168795249
(3aR,6aS)-N-[6-(2-fluoro-3-isocyanophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795249) has the molecular formula C25H27F4N5O and a molecular weight of 489.52 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-(2-fluoro-3-isocyanophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[6-(2-fluoro-3-isocyanophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795249 |
| Molecular Formula | C25H27F4N5O |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (3aR,6aS)-N-[6-(2-fluoro-3-isocyanophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [C-]#[N+]c1cccc(-c2cc(C(F)(F)F)c(NC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)c1F |
| InChI | InChI=1S/C25H27F4N5O/c1-30-21-4-2-3-19(23(21)26)22-11-20(25(27,28)29)24(33-32-22)31-18-9-16-13-34(14-17(16)10-18)12-15-5-7-35-8-6-15/h2-4,11,15-18H,5-10,12-14H2,(H,31,33)/t16-,17+,18? |
| InChIKey | ZGUPOOYVKNDERS-JWTNVVGKSA-N |
| XLogP | 5.40 |
| TPSA | 54.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|