C23H26ClF3N4O — CID 168861345
(3aS,6aS)-N-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168861345) has the molecular formula C23H26ClF3N4O and a molecular weight of 466.94 g/mol. Its IUPAC name is (3aS,6aS)-N-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aS)-N-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168861345 |
| Molecular Formula | C23H26ClF3N4O |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (3aS,6aS)-N-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1ccc(-c2cc(Cl)nnc2NC2C[C@@H]3CN(CC4CCOCC4)C[C@H]3C2)c(F)c1F |
| InChI | InChI=1S/C23H26ClF3N4O/c24-20-9-18(17-1-2-19(25)22(27)21(17)26)23(30-29-20)28-16-7-14-11-31(12-15(14)8-16)10-13-3-5-32-6-4-13/h1-2,9,13-16H,3-8,10-12H2,(H,28,30)/t14-,15-/m1/s1 |
| InChIKey | XBHYCCJBZUUMKH-HUUCEWRRSA-N |
| XLogP | 4.76 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|