C25H30F4N4O — CID 168795278
N-[6-(5-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795278) has the molecular formula C25H30F4N4O and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[6-(5-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-[6-(5-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795278 |
| Molecular Formula | C25H30F4N4O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[6-(5-fluoro-2-methylphenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cc1ccc(F)cc1-c1cc(C(F)(F)F)c(NC2CC3CN(CC4CCOCC4)CC3C2)nn1 |
| InChI | InChI=1S/C25H30F4N4O/c1-15-2-3-19(26)10-21(15)23-11-22(25(27,28)29)24(32-31-23)30-20-8-17-13-33(14-18(17)9-20)12-16-4-6-34-7-5-16/h2-3,10-11,16-18,20H,4-9,12-14H2,1H3,(H,30,32) |
| InChIKey | VHMXGKFAZLKGGC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |