C25H28BF4N3O2 — CID 174071121
CID 174071121 (PubChem CID 174071121) has the molecular formula C25H28BF4N3O2 and a molecular weight of 489.32 g/mol.
| Compound Name | CID 174071121 |
|---|---|
| PubChem CID | 174071121 |
| Molecular Formula | C25H28BF4N3O2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | — |
| SMILES | [B]C1(Oc2cc(C(F)(F)F)c(-c3cc(F)ccc3C)nn2)C[C@H]2CN(CC3CCOCC3)C[C@H]2C1 |
| InChI | InChI=1S/C25H28BF4N3O2/c1-15-2-3-19(27)8-20(15)23-21(25(28,29)30)9-22(31-32-23)35-24(26)10-17-13-33(14-18(17)11-24)12-16-4-6-34-7-5-16/h2-3,8-9,16-18H,4-7,10-14H2,1H3/t17-,18+,24? |
| InChIKey | NTUAINMRLWSQJM-QLCVBSLISA-N |
| XLogP | 4.62 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|