C10H14N2O — CID 175885306
(2R)-5,5-dideuterio-2-(6-methyl-2-pyridinyl)morpholine (PubChem CID 175885306) has the molecular formula C10H14N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (2R)-5,5-dideuterio-2-(6-methyl-2-pyridinyl)morpholine.
| Compound Name | (2R)-5,5-dideuterio-2-(6-methyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 175885306 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2R)-5,5-dideuterio-2-(6-methyl-2-pyridinyl)morpholine |
| SMILES | [2H]C1([2H])CO[C@@H](c2cccc(C)n2)CN1 |
| InChI | InChI=1S/C10H14N2O/c1-8-3-2-4-9(12-8)10-7-11-5-6-13-10/h2-4,10-11H,5-7H2,1H3/t10-/m1/s1/i5D2 |
| InChIKey | GACANOMBWRJYBK-VPQSDVOVSA-N |
| XLogP | 1.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |