C12H18N2O — CID 176629701
4-[(2S)-5,5-dideuteriomorpholin-2-yl]-N,N-dimethylaniline (PubChem CID 176629701) has the molecular formula C12H18N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-[(2S)-5,5-dideuteriomorpholin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2S)-5,5-dideuteriomorpholin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 176629701 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-[(2S)-5,5-dideuteriomorpholin-2-yl]-N,N-dimethylaniline |
| SMILES | [2H]C1([2H])CO[C@@H](c2ccc(N(C)C)cc2)CN1 |
| InChI | InChI=1S/C12H18N2O/c1-14(2)11-5-3-10(4-6-11)12-9-13-7-8-15-12/h3-6,12-13H,7-9H2,1-2H3/t12-/m1/s1/i7D2 |
| InChIKey | ASFKELOGBBCCOB-YDYFSBEESA-N |
| XLogP | 1.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|