About (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol
(3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol (PubChem CID 175887740) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol |
| PubChem CID | 175887740 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol |
| SMILES | CO[C@@H]1CN(CC2=CCNC=C2)C[C@@H]1O |
| InChI | InChI=1S/C11H18N2O2/c1-15-11-8-13(7-10(11)14)6-9-2-4-12-5-3-9/h2-4,10-12,14H,5-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | YPNMUTHNEYWXCD-WDEREUQCSA-N |
| XLogP | -0.28 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol?
The IUPAC name of (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol (CID 175887740) is (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol.
What is the SMILES notation for (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol?
The canonical SMILES for (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol is CO[C@@H]1CN(CC2=CCNC=C2)C[C@@H]1O.
What is the InChIKey of (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol?
The InChIKey is YPNMUTHNEYWXCD-WDEREUQCSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-15-11-8-13(7-10(11)14)6-9-2-4-12-5-3-9/h2-4,10-12,14H,5-8H2,1H3/t10-,11+/m0/s1.
What are the key properties of (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol?
(3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol has a molecular weight of 210.28 g/mol, XLogP of -0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-(1,2-dihydropyridin-4-ylmethyl)-4-methoxypyrrolidin-3-ol is sourced from PubChem (CID 175887740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).