C13H18N4 — CID 175889087
1-methyl-3-piperidin-3-ylindazol-7-amine (PubChem CID 175889087) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-methyl-3-piperidin-3-ylindazol-7-amine.
| Compound Name | 1-methyl-3-piperidin-3-ylindazol-7-amine |
|---|---|
| PubChem CID | 175889087 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-methyl-3-piperidin-3-ylindazol-7-amine |
| SMILES | Cn1nc(C2CCCNC2)c2cccc(N)c21 |
| InChI | InChI=1S/C13H18N4/c1-17-13-10(5-2-6-11(13)14)12(16-17)9-4-3-7-15-8-9/h2,5-6,9,15H,3-4,7-8,14H2,1H3 |
| InChIKey | FIPVRGMVJCGUAH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|