C23H20F2O4 — CID 175894915
ethyl 6-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate (PubChem CID 175894915) has the molecular formula C23H20F2O4 and a molecular weight of 398.41 g/mol. Its IUPAC name is ethyl 6-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate.
| Compound Name | ethyl 6-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate |
|---|---|
| PubChem CID | 175894915 |
| Molecular Formula | C23H20F2O4 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl 6-(4-fluorophenyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate |
| SMILES | CCOC(=O)CC(C(=O)/C=C/c1ccc(F)cc1)=C(O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20F2O4/c1-2-29-23(28)15-20(21(26)13-7-16-3-9-18(24)10-4-16)22(27)14-8-17-5-11-19(25)12-6-17/h3-14,26H,2,15H2,1H3/b13-7?,14-8+,21-20? |
| InChIKey | LKBASGBIYGSEKZ-AOJGTOPASA-N |
| XLogP | 5.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|