C27H28N2O6 — CID 168866692
ethyl (3Z,5E)-6-(4-acetamidophenyl)-3-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate (PubChem CID 168866692) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is ethyl (3Z,5E)-6-(4-acetamidophenyl)-3-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate.
| Compound Name | ethyl (3Z,5E)-6-(4-acetamidophenyl)-3-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate |
|---|---|
| PubChem CID | 168866692 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl (3Z,5E)-6-(4-acetamidophenyl)-3-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-hydroxyhexa-3,5-dienoate |
| SMILES | CCOC(=O)C/C(C(=O)/C=C/c1ccc(NC(C)=O)cc1)=C(O)\C=C\c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C27H28N2O6/c1-4-35-27(34)17-24(25(32)15-9-20-5-11-22(12-6-20)28-18(2)30)26(33)16-10-21-7-13-23(14-8-21)29-19(3)31/h5-16,32H,4,17H2,1-3H3,(H,28,30)(H,29,31)/b15-9+,16-10+,25-24- |
| InChIKey | CFNMPHZTCKAHNV-RCYFYLICSA-N |
| XLogP | 4.66 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|