C24H27NO5 — CID 11327312
diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-benzylpropanedioate (PubChem CID 11327312) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 11327312 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-benzylpropanedioate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(NC(C)=O)cc1)(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C24H27NO5/c1-4-29-22(27)24(23(28)30-5-2,17-20-9-7-6-8-10-20)16-15-19-11-13-21(14-12-19)25-18(3)26/h6-16H,4-5,17H2,1-3H3,(H,25,26)/b16-15+ |
| InChIKey | DGDXDEAYGOMPMY-FOCLMDBBSA-N |
| XLogP | 4.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|