C25H29NO6 — CID 102351724
diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-[(3-methoxyphenyl)methyl]propanedioate (PubChem CID 102351724) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-[(3-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-[(3-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 102351724 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | diethyl 2-[(E)-2-(4-acetamidophenyl)ethenyl]-2-[(3-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(NC(C)=O)cc1)(Cc1cccc(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C25H29NO6/c1-5-31-23(28)25(24(29)32-6-2,17-20-8-7-9-22(16-20)30-4)15-14-19-10-12-21(13-11-19)26-18(3)27/h7-16H,5-6,17H2,1-4H3,(H,26,27)/b15-14+ |
| InChIKey | JVUHGVONYLLGPE-CCEZHUSRSA-N |
| XLogP | 4.02 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|