C24H33BrO2 — CID 175897482
2-bromo-4-(methoxymethoxy)-1,3-bis(2-methylbutan-2-yl)-5-phenylbenzene (PubChem CID 175897482) has the molecular formula C24H33BrO2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-bromo-4-(methoxymethoxy)-1,3-bis(2-methylbutan-2-yl)-5-phenylbenzene.
| Compound Name | 2-bromo-4-(methoxymethoxy)-1,3-bis(2-methylbutan-2-yl)-5-phenylbenzene |
|---|---|
| PubChem CID | 175897482 |
| Molecular Formula | C24H33BrO2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-bromo-4-(methoxymethoxy)-1,3-bis(2-methylbutan-2-yl)-5-phenylbenzene |
| SMILES | CCC(C)(C)c1cc(-c2ccccc2)c(OCOC)c(C(C)(C)CC)c1Br |
| InChI | InChI=1S/C24H33BrO2/c1-8-23(3,4)19-15-18(17-13-11-10-12-14-17)22(27-16-26-7)20(21(19)25)24(5,6)9-2/h10-15H,8-9,16H2,1-7H3 |
| InChIKey | UWSDXXAXPWMSLH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|