C21H27BrO2 — CID 175988120
1-bromo-5-tert-butyl-2-(methoxymethoxy)-3-(4-propan-2-ylphenyl)benzene (PubChem CID 175988120) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-bromo-5-tert-butyl-2-(methoxymethoxy)-3-(4-propan-2-ylphenyl)benzene.
| Compound Name | 1-bromo-5-tert-butyl-2-(methoxymethoxy)-3-(4-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 175988120 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-bromo-5-tert-butyl-2-(methoxymethoxy)-3-(4-propan-2-ylphenyl)benzene |
| SMILES | COCOc1c(Br)cc(C(C)(C)C)cc1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H27BrO2/c1-14(2)15-7-9-16(10-8-15)18-11-17(21(3,4)5)12-19(22)20(18)24-13-23-6/h7-12,14H,13H2,1-6H3 |
| InChIKey | VGHNVXFBDQDRGK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|