C20H31BrO2 — CID 170210843
1-bromo-5-tert-butyl-3-(3-ethylhex-5-en-3-yl)-2-(methoxymethoxy)benzene (PubChem CID 170210843) has the molecular formula C20H31BrO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 1-bromo-5-tert-butyl-3-(3-ethylhex-5-en-3-yl)-2-(methoxymethoxy)benzene.
| Compound Name | 1-bromo-5-tert-butyl-3-(3-ethylhex-5-en-3-yl)-2-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 170210843 |
| Molecular Formula | C20H31BrO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-bromo-5-tert-butyl-3-(3-ethylhex-5-en-3-yl)-2-(methoxymethoxy)benzene |
| SMILES | C=CCC(CC)(CC)c1cc(C(C)(C)C)cc(Br)c1OCOC |
| InChI | InChI=1S/C20H31BrO2/c1-8-11-20(9-2,10-3)16-12-15(19(4,5)6)13-17(21)18(16)23-14-22-7/h8,12-13H,1,9-11,14H2,2-7H3 |
| InChIKey | UMVWUTUOOZQHCX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|