C16H22N2O2 — CID 175898177
(2S)-3-ethyl-3-(1H-indol-3-yl)-2-(methylamino)pentanoic acid (PubChem CID 175898177) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2S)-3-ethyl-3-(1H-indol-3-yl)-2-(methylamino)pentanoic acid.
| Compound Name | (2S)-3-ethyl-3-(1H-indol-3-yl)-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 175898177 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2S)-3-ethyl-3-(1H-indol-3-yl)-2-(methylamino)pentanoic acid |
| SMILES | CCC(CC)(c1c[nH]c2ccccc12)[C@H](NC)C(=O)O |
| InChI | InChI=1S/C16H22N2O2/c1-4-16(5-2,14(17-3)15(19)20)12-10-18-13-9-7-6-8-11(12)13/h6-10,14,17-18H,4-5H2,1-3H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | ZGWOEECGNKEDSE-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |