C37H40ClN3 — CID 175899476
[4-[bis[4-[2-(dimethylamino)phenyl]phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride (PubChem CID 175899476) has the molecular formula C37H40ClN3 and a molecular weight of 562.20 g/mol. Its IUPAC name is [4-[bis[4-[2-(dimethylamino)phenyl]phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride.
| Compound Name | [4-[bis[4-[2-(dimethylamino)phenyl]phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 175899476 |
| Molecular Formula | C37H40ClN3 |
| Molecular Weight | 562.20 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [4-[bis[4-[2-(dimethylamino)phenyl]phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccccc1-c1ccc(C(c2ccc(-c3ccccc3N(C)C)cc2)C2C=CC(=[N+](C)C)C=C2)cc1.[Cl-] |
| InChI | InChI=1S/C37H40N3.ClH/c1-38(2)32-25-23-31(24-26-32)37(29-19-15-27(16-20-29)33-11-7-9-13-35(33)39(3)4)30-21-17-28(18-22-30)34-12-8-10-14-36(34)40(5)6;/h7-26,31,37H,1-6H3;1H/q+1;/p-1 |
| InChIKey | YNWBEHNADXUWEC-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|