C30H42N3O2Si+ — CID 20709958
[4-[[4-[3-[dihydroxy(propan-2-yl)silyl]propyliminomethyl]phenyl]-[4-(dimethylamino)phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 20709958) has the molecular formula C30H42N3O2Si+ and a molecular weight of 504.77 g/mol. Its IUPAC name is [4-[[4-[3-[dihydroxy(propan-2-yl)silyl]propyliminomethyl]phenyl]-[4-(dimethylamino)phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-[3-[dihydroxy(propan-2-yl)silyl]propyliminomethyl]phenyl]-[4-(dimethylamino)phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 20709958 |
| Molecular Formula | C30H42N3O2Si+ |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | [4-[[4-[3-[dihydroxy(propan-2-yl)silyl]propyliminomethyl]phenyl]-[4-(dimethylamino)phenyl]methyl]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CC(C)[Si](O)(O)CCC/N=C/c1ccc(C(c2ccc(N(C)C)cc2)C2C=CC(=[N+](C)C)C=C2)cc1 |
| InChI | InChI=1S/C30H42N3O2Si/c1-23(2)36(34,35)21-7-20-31-22-24-8-10-25(11-9-24)30(26-12-16-28(17-13-26)32(3)4)27-14-18-29(19-15-27)33(5)6/h8-19,22-23,26,30,34-35H,7,20-21H2,1-6H3/q+1/b31-22+ |
| InChIKey | QUSWEVDULFTKRQ-DFKUXCBWSA-N |
| XLogP | 4.99 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|