C24H27N2OP — CID 101031441
4-(3-diphenylphosphanyloxypropyliminomethyl)-N,N-dimethylaniline (PubChem CID 101031441) has the molecular formula C24H27N2OP and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-(3-diphenylphosphanyloxypropyliminomethyl)-N,N-dimethylaniline.
| Compound Name | 4-(3-diphenylphosphanyloxypropyliminomethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101031441 |
| Molecular Formula | C24H27N2OP |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-(3-diphenylphosphanyloxypropyliminomethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/CCCOP(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N2OP/c1-26(2)22-16-14-21(15-17-22)20-25-18-9-19-27-28(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-17,20H,9,18-19H2,1-2H3/b25-20+ |
| InChIKey | LBCNEYCXSQTPEO-LKUDQCMESA-N |
| XLogP | 4.63 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|