C21H19N3 — CID 6872335
4-[(E)-carbazol-9-yliminomethyl]-N,N-dimethylaniline (PubChem CID 6872335) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[(E)-carbazol-9-yliminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-carbazol-9-yliminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 6872335 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-[(E)-carbazol-9-yliminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C21H19N3/c1-23(2)17-13-11-16(12-14-17)15-22-24-20-9-5-3-7-18(20)19-8-4-6-10-21(19)24/h3-15H,1-2H3/b22-15+ |
| InChIKey | VXJCQPXPEUCHTL-PXLXIMEGSA-N |
| XLogP | 4.74 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|