C19H22N2 — CID 102364701
N,N-dimethyl-4-[(2-methyl-1-phenylprop-1-enyl)iminomethyl]aniline (PubChem CID 102364701) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2-methyl-1-phenylprop-1-enyl)iminomethyl]aniline.
| Compound Name | N,N-dimethyl-4-[(2-methyl-1-phenylprop-1-enyl)iminomethyl]aniline |
|---|---|
| PubChem CID | 102364701 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N,N-dimethyl-4-[(2-methyl-1-phenylprop-1-enyl)iminomethyl]aniline |
| SMILES | CC(C)=C(/N=C/c1ccc(N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-15(2)19(17-8-6-5-7-9-17)20-14-16-10-12-18(13-11-16)21(3)4/h5-14H,1-4H3/b20-14+ |
| InChIKey | XOVROTZZLXWTQW-XSFVSMFZSA-N |
| XLogP | 4.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|