C13H16F5NO2S — CID 175901598
tert-butyl-[[1-[4-(difluoromethoxy)phenyl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium (PubChem CID 175901598) has the molecular formula C13H16F5NO2S and a molecular weight of 345.33 g/mol. Its IUPAC name is tert-butyl-[[1-[4-(difluoromethoxy)phenyl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-[4-(difluoromethoxy)phenyl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175901598 |
| Molecular Formula | C13H16F5NO2S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | tert-butyl-[[1-[4-(difluoromethoxy)phenyl]-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(c1ccc(OC(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H16F5NO2S/c1-12(2,3)22(20)19-10(13(16,17)18)8-4-6-9(7-5-8)21-11(14)15/h4-7,10-11,19H,1-3H3 |
| InChIKey | LFDIAYAFZMOWIE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|