C25H21N3O5 — CID 175904371
2-(1,3-benzodioxol-5-yl)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylindole-3-carboxamide (PubChem CID 175904371) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylindole-3-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 175904371 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylindole-3-carboxamide |
| SMILES | Cc1ccc2c(c1)c(C(N)=O)c(-c1ccc3c(c1)OCO3)n2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-14-2-8-19-18(10-14)22(24(26)29)23(17-7-9-20-21(11-17)33-13-32-20)28(19)12-15-3-5-16(6-4-15)25(30)27-31/h2-11,31H,12-13H2,1H3,(H2,26,29)(H,27,30) |
| InChIKey | ZFECDOMQBRYNHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|