C10H14N6O — CID 175908437
1-(oxolan-2-ylmethyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 175908437) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 1-(oxolan-2-ylmethyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 175908437 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | Nc1nc(N)c2cnn(CC3CCCO3)c2n1 |
| InChI | InChI=1S/C10H14N6O/c11-8-7-4-13-16(5-6-2-1-3-17-6)9(7)15-10(12)14-8/h4,6H,1-3,5H2,(H4,11,12,14,15) |
| InChIKey | OOZLVVOJCKMHQC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |