C15H18FNO — CID 175908847
N-tert-butyl-4-[(1E,3Z)-4-fluorobuta-1,3-dienyl]benzamide (PubChem CID 175908847) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is N-tert-butyl-4-[(1E,3Z)-4-fluorobuta-1,3-dienyl]benzamide.
| Compound Name | N-tert-butyl-4-[(1E,3Z)-4-fluorobuta-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 175908847 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-tert-butyl-4-[(1E,3Z)-4-fluorobuta-1,3-dienyl]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(/C=C/C=C\F)cc1 |
| InChI | InChI=1S/C15H18FNO/c1-15(2,3)17-14(18)13-9-7-12(8-10-13)6-4-5-11-16/h4-11H,1-3H3,(H,17,18)/b6-4+,11-5- |
| InChIKey | HUAZNPGKHQJIDG-XEUXBCEPSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|