C20H16O7 — CID 175909990
2-hydroxy-1-phenanthren-1-ylpropane-1,2,3-tricarboxylic acid (PubChem CID 175909990) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-hydroxy-1-phenanthren-1-ylpropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-1-phenanthren-1-ylpropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175909990 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-hydroxy-1-phenanthren-1-ylpropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(C(=O)O)c1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C20H16O7/c21-16(22)10-20(27,19(25)26)17(18(23)24)15-7-3-6-13-12-5-2-1-4-11(12)8-9-14(13)15/h1-9,17,27H,10H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | AOPMMENVDLAEIZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|