C35H38O5 — CID 68534107
3-cyclodecyl-3-hydroxy-2,4-dinaphthalen-1-ylpentanedioic acid (PubChem CID 68534107) has the molecular formula C35H38O5 and a molecular weight of 538.68 g/mol. Its IUPAC name is 3-cyclodecyl-3-hydroxy-2,4-dinaphthalen-1-ylpentanedioic acid.
| Compound Name | 3-cyclodecyl-3-hydroxy-2,4-dinaphthalen-1-ylpentanedioic acid |
|---|---|
| PubChem CID | 68534107 |
| Molecular Formula | C35H38O5 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 3-cyclodecyl-3-hydroxy-2,4-dinaphthalen-1-ylpentanedioic acid |
| SMILES | O=C(O)C(c1cccc2ccccc12)C(O)(C1CCCCCCCCC1)C(C(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C35H38O5/c36-33(37)31(29-22-12-16-24-14-8-10-20-27(24)29)35(40,26-18-6-4-2-1-3-5-7-19-26)32(34(38)39)30-23-13-17-25-15-9-11-21-28(25)30/h8-17,20-23,26,31-32,40H,1-7,18-19H2,(H,36,37)(H,38,39) |
| InChIKey | DHCQGTVWNJZLJC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |