C11H12N4S — CID 175911341
3-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2,4-thiadiazole (PubChem CID 175911341) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 3-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2,4-thiadiazole.
| Compound Name | 3-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 175911341 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(6-pyrrolidin-1-yl-3-pyridinyl)-1,2,4-thiadiazole |
| SMILES | c1nc(-c2ccc(N3CCCC3)nc2)ns1 |
| InChI | InChI=1S/C11H12N4S/c1-2-6-15(5-1)10-4-3-9(7-12-10)11-13-8-16-14-11/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | KLCVBENVDHGQSJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |