C15H18N4O5S — CID 175915252
4-[2-(methanesulfonamido)-4-methoxyanilino]-N-methoxypyridine-3-carboxamide (PubChem CID 175915252) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-[2-(methanesulfonamido)-4-methoxyanilino]-N-methoxypyridine-3-carboxamide.
| Compound Name | 4-[2-(methanesulfonamido)-4-methoxyanilino]-N-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 175915252 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[2-(methanesulfonamido)-4-methoxyanilino]-N-methoxypyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnccc1Nc1ccc(OC)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H18N4O5S/c1-23-10-4-5-13(14(8-10)19-25(3,21)22)17-12-6-7-16-9-11(12)15(20)18-24-2/h4-9,19H,1-3H3,(H,16,17)(H,18,20) |
| InChIKey | FYGTXULGAOOHMC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|