C27H25N3O3 — CID 175916115
(E)-3-[3-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-pyridin-4-ylprop-2-en-1-one (PubChem CID 175916115) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (E)-3-[3-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 175916115 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (E)-3-[3-(5-benzyl-2-oxa-5,8-diazaspiro[3.4]octane-8-carbonyl)phenyl]-1-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(C(=O)N2CCN(Cc3ccccc3)C23COC3)c1)c1ccncc1 |
| InChI | InChI=1S/C27H25N3O3/c31-25(23-11-13-28-14-12-23)10-9-21-7-4-8-24(17-21)26(32)30-16-15-29(27(30)19-33-20-27)18-22-5-2-1-3-6-22/h1-14,17H,15-16,18-20H2/b10-9+ |
| InChIKey | RYTDMJFCMVKMGD-MDZDMXLPSA-N |
| XLogP | 3.66 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|