C15H22N4O — CID 175918163
2-methyl-1-pyridin-2-yl-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 175918163) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-methyl-1-pyridin-2-yl-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 2-methyl-1-pyridin-2-yl-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 175918163 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-methyl-1-pyridin-2-yl-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CN1CCC2(CCN(C(N)=O)CC2)C1c1ccccn1 |
| InChI | InChI=1S/C15H22N4O/c1-18-9-5-15(6-10-19(11-7-15)14(16)20)13(18)12-4-2-3-8-17-12/h2-4,8,13H,5-7,9-11H2,1H3,(H2,16,20) |
| InChIKey | PZILFHFNWLRJMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |