C6H10FNO2 — CID 175918416
[(6S)-6-fluoro-1,4-oxazepan-2-ylidene]methanol (PubChem CID 175918416) has the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. Its IUPAC name is [(6S)-6-fluoro-1,4-oxazepan-2-ylidene]methanol.
| Compound Name | [(6S)-6-fluoro-1,4-oxazepan-2-ylidene]methanol |
|---|---|
| PubChem CID | 175918416 |
| Molecular Formula | C6H10FNO2 |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | [(6S)-6-fluoro-1,4-oxazepan-2-ylidene]methanol |
| SMILES | OC=C1CNC[C@H](F)CO1 |
| InChI | InChI=1S/C6H10FNO2/c7-5-1-8-2-6(3-9)10-4-5/h3,5,8-9H,1-2,4H2/t5-/m0/s1 |
| InChIKey | MYFOAXRAAZFTHC-YFKPBYRVSA-N |
| XLogP | 0.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|