C13H14ClF3N2 — CID 175919334
6-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-2-azaspiro[3.3]heptane (PubChem CID 175919334) has the molecular formula C13H14ClF3N2 and a molecular weight of 290.72 g/mol. Its IUPAC name is 6-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-2-azaspiro[3.3]heptane.
| Compound Name | 6-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 175919334 |
| Molecular Formula | C13H14ClF3N2 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 6-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-2-azaspiro[3.3]heptane |
| SMILES | FC(F)(F)c1ccc(CC2CC3(CNC3)C2)nc1Cl |
| InChI | InChI=1S/C13H14ClF3N2/c14-11-10(13(15,16)17)2-1-9(19-11)3-8-4-12(5-8)6-18-7-12/h1-2,8,18H,3-7H2 |
| InChIKey | RSHAALRWSOLEMC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|