C14H17F3N2OS — CID 177182594
[6-(2-azaspiro[3.3]heptan-6-ylmethyl)-3-pyridinyl]-methylidene-oxo-(trifluoromethyl)-λ6-sulfane (PubChem CID 177182594) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is [6-(2-azaspiro[3.3]heptan-6-ylmethyl)-3-pyridinyl]-methylidene-oxo-(trifluoromethyl)-λ6-sulfane.
| Compound Name | [6-(2-azaspiro[3.3]heptan-6-ylmethyl)-3-pyridinyl]-methylidene-oxo-(trifluoromethyl)-λ6-sulfane |
|---|---|
| PubChem CID | 177182594 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [6-(2-azaspiro[3.3]heptan-6-ylmethyl)-3-pyridinyl]-methylidene-oxo-(trifluoromethyl)-λ6-sulfane |
| SMILES | C=S(=O)(c1ccc(CC2CC3(CNC3)C2)nc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2OS/c1-21(20,14(15,16)17)12-3-2-11(19-7-12)4-10-5-13(6-10)8-18-9-13/h2-3,7,10,18H,1,4-6,8-9H2 |
| InChIKey | MELWUVOBPMGONP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|