C13H15F3N2 — CID 162745967
6-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-2-azaspiro[3.3]heptane (PubChem CID 162745967) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 6-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-2-azaspiro[3.3]heptane.
| Compound Name | 6-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 162745967 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 6-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-2-azaspiro[3.3]heptane |
| SMILES | FC(F)(F)c1ccc(CC2CC3(CNC3)C2)cn1 |
| InChI | InChI=1S/C13H15F3N2/c14-13(15,16)11-2-1-9(6-18-11)3-10-4-12(5-10)7-17-8-12/h1-2,6,10,17H,3-5,7-8H2 |
| InChIKey | YCXCPSWUDIXSOH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |