C18H25NO — CID 175920984
1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indole (PubChem CID 175920984) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indole.
| Compound Name | 1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indole |
|---|---|
| PubChem CID | 175920984 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indole |
| SMILES | CC(C)(C)Cn1ccc2ccc(C3CCOCC3)cc21 |
| InChI | InChI=1S/C18H25NO/c1-18(2,3)13-19-9-6-15-4-5-16(12-17(15)19)14-7-10-20-11-8-14/h4-6,9,12,14H,7-8,10-11,13H2,1-3H3 |
| InChIKey | FEKMGRBEFZILMR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |