C18H16FN — CID 175924515
1-benzyl-7'-fluorospiro[azetidine-3,1'-indene] (PubChem CID 175924515) has the molecular formula C18H16FN and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-benzyl-7'-fluorospiro[azetidine-3,1'-indene].
| Compound Name | 1-benzyl-7'-fluorospiro[azetidine-3,1'-indene] |
|---|---|
| PubChem CID | 175924515 |
| Molecular Formula | C18H16FN |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-benzyl-7'-fluorospiro[azetidine-3,1'-indene] |
| SMILES | Fc1cccc2c1C1(C=C2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H16FN/c19-16-8-4-7-15-9-10-18(17(15)16)12-20(13-18)11-14-5-2-1-3-6-14/h1-10H,11-13H2 |
| InChIKey | CTFROBYGOBYYSY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |