C15H12N4 — CID 175926961
2-(1H-indol-2-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 175926961) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(1H-indol-2-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(1H-indol-2-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 175926961 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(1H-indol-2-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1ccn2nc(-c3cc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C15H12N4/c1-10-6-7-19-14(8-10)17-15(18-19)13-9-11-4-2-3-5-12(11)16-13/h2-9,16H,1H3 |
| InChIKey | OGYRDRIYDHNGGQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |